|
CAS#: 57562-58-0 Product: 4-Methyl-5-Phenyl-Pyrimidine No suppilers available for the product. |
| Name | 4-Methyl-5-Phenyl-Pyrimidine |
|---|---|
| Synonyms | 4-Methyl-5-Phenyl-Pyrimidine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 |
| CAS Registry Number | 57562-58-0 |
| SMILES | C1=NC(=C(C=N1)C2=CC=CC=C2)C |
| InChI | 1S/C11H10N2/c1-9-11(7-12-8-13-9)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | RPXGYQFOIZMYAF-UHFFFAOYSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.525°C at 760 mmHg (Cal.) |
| Flash point | 129.304°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-5-Phenyl-Pyrimidine |