|
CAS#: 576-11-4 Product: 3-Ethyl-N,N,2-Trimethyl-1H-Indol-5-Amine No suppilers available for the product. |
| Name | 3-Ethyl-N,N,2-Trimethyl-1H-Indol-5-Amine |
|---|---|
| Synonyms | (3-Ethyl-2-Methyl-1H-Indol-5-Yl)-Dimethyl-Amine; 1H-Indol-5-Amine, 3-Ethyl-N,N,2-Trimethyl-; Indole, 5-(Dimethylamino)-3-Ethyl-2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 |
| CAS Registry Number | 576-11-4 |
| SMILES | C1=C(C=CC2=C1C(=C([NH]2)C)CC)N(C)C |
| InChI | 1S/C13H18N2/c1-5-11-9(2)14-13-7-6-10(15(3)4)8-12(11)13/h6-8,14H,5H2,1-4H3 |
| InChIKey | IOYNGCZNYGEZRO-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.072°C at 760 mmHg (Cal.) |
| Flash point | 168.542°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-N,N,2-Trimethyl-1H-Indol-5-Amine |