| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 2-(2,5-Dimethylphenyl)-2-Hydroxyacetic Acid |
|---|---|
| Synonyms | 2-(2,5-Dimethylphenyl)-2-Hydroxy-Acetic Acid; 2-(2,5-Dimethylphenyl)-2-Hydroxy-Ethanoic Acid; Oprea1_523734 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 5766-40-5 |
| SMILES | C1=C(C(C(O)=O)O)C(=CC=C1C)C |
| InChI | 1S/C10H12O3/c1-6-3-4-7(2)8(5-6)9(11)10(12)13/h3-5,9,11H,1-2H3,(H,12,13) |
| InChIKey | RJKPCVWDAMENNV-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.505°C at 760 mmHg (Cal.) |
| Flash point | 177.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,5-Dimethylphenyl)-2-Hydroxyacetic Acid |