Online Database of Chemicals from Around the World
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl Dihydrogen Phosphate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H6F25O4P |
| Molecular Weight | 744.13 |
| CAS Registry Number | 57678-07-6 |
| EINECS | 260-901-1 |
| SMILES | C(O[P](=O)(O)O)CC(C(C(C(C(C(C(C(C(C(C(F)(F)C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChI | 1S/C14H6F25O4P/c15-3(16,1-2-43-44(40,41)42)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)9(27,28)10(29,30)11(31,32)12(33,34)13(35,36)14(37,38)39/h1-2H2,(H2,40,41,42) |
| InChIKey | ROUGOWJCVFOXHO-UHFFFAOYSA-N |
| Density | 1.764g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.213°C at 760 mmHg (Cal.) |
| Flash point | 167.417°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl Dihydrogen Phosphate |
