|
CAS#: 57696-94-3 Product: 2-Dimethylamino-3,5,5-Trimethylcyclohex-2-En-1-One No suppilers available for the product. |
| Name | 2-Dimethylamino-3,5,5-Trimethylcyclohex-2-En-1-One |
|---|---|
| Synonyms | 2-Dimethylamino-3,5,5-Trimethyl-Cyclohex-2-En-1-One; 2-Dimethylamino-3,5,5-Trimethyl-1-Cyclohex-2-Enone; 2-(Dimethylamino)-3,5,5-Trimethylcyclohex-2-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 |
| CAS Registry Number | 57696-94-3 |
| EINECS | 260-907-4 |
| SMILES | CC1(CC(=O)C(=C(C1)C)N(C)C)C |
| InChI | 1S/C11H19NO/c1-8-6-11(2,3)7-9(13)10(8)12(4)5/h6-7H2,1-5H3 |
| InChIKey | WEDSJFGQPPOZNR-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.484°C at 760 mmHg (Cal.) |
| Flash point | 89.269°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Dimethylamino-3,5,5-Trimethylcyclohex-2-En-1-One |