|
CAS#: 5776-76-1 Product: Butestrol No suppilers available for the product. |
| Name | Butestrol |
|---|---|
| Synonyms | 4-[(1R,2R)-2-(4-Hydroxyphenyl)-1-Methyl-Propyl]Phenol; 4-[(1R,2R)-2-(4-Hydroxyphenyl)-1-Methylpropyl]Phenol; Racemic-Butestrol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 |
| CAS Registry Number | 5776-76-1 |
| SMILES | [C@@H]([C@H](C1=CC=C(O)C=C1)C)(C2=CC=C(O)C=C2)C |
| InChI | 1S/C16H18O2/c1-11(13-3-7-15(17)8-4-13)12(2)14-5-9-16(18)10-6-14/h3-12,17-18H,1-2H3/t11-,12-/m1/s1 |
| InChIKey | GDUYFVYTXYOMSJ-VXGBXAGGSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.207°C at 760 mmHg (Cal.) |
| Flash point | 172.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butestrol |