|
CAS#: 577778-06-4 Product: (2R,3S)-2,3-Azetidinedicarboxylic Acid No suppilers available for the product. |
| Name | (2R,3S)-2,3-Azetidinedicarboxylic Acid |
|---|---|
| Synonyms | (2R,3S)-azetidine-2,3-dicarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7NO4 |
| Molecular Weight | 145.11 |
| CAS Registry Number | 577778-06-4 |
| SMILES | O=C(O)[C@@H]1NC[C@@H]1C(=O)O |
| InChI | 1S/C5H7NO4/c7-4(8)2-1-6-3(2)5(9)10/h2-3,6H,1H2,(H,7,8)(H,9,10)/t2-,3+/m0/s1 |
| InChIKey | BLLPFMQOLSYTBX-STHAYSLISA-N |
| Density | 1.586g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.776°C at 760 mmHg (Cal.) |
| Flash point | 213.116°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S)-2,3-Azetidinedicarboxylic Acid |