Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Forphenicine |
|---|---|
| Synonyms | 2-Amino-2-(4-Formyl-3-Hydroxy-Phenyl)Acetic Acid; 2-Amino-2-(3-Hydroxy-4-Methanoyl-Phenyl)Ethanoic Acid; 4-Formyl-3-Hydroxyphenylglycine |
| Molecular Structure |  |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 |
| CAS Registry Number | 57784-96-0 |
| SMILES | C1=C(C(=CC=C1C(C(O)=O)N)C=O)O |
| InChI | 1S/C9H9NO4/c10-8(9(13)14)5-1-2-6(4-11)7(12)3-5/h1-4,8,12H,10H2,(H,13,14) |
| InChIKey | MWSKDGPKFCWPOF-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.449°C at 760 mmHg (Cal.) |
| Flash point | 207.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Forphenicine |