|
CAS#: 57803-52-8 Product: N-Methyl-2,6-Dichloroisonicotinic Hydrazide No suppilers available for the product. |
| Name | N-Methyl-2,6-Dichloroisonicotinic Hydrazide |
|---|---|
| Synonyms | 2,6-Dichloro-N-Methyl-Pyridine-4-Carbohydrazide; 2,6-Dichloro-N-Methyl-4-Pyridinecarbohydrazide; 2,6-Dichloro-N-Methyl-Isonicotinohydrazide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7Cl2N3O |
| Molecular Weight | 220.06 |
| CAS Registry Number | 57803-52-8 |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(N(C)N)=O |
| InChI | 1S/C7H7Cl2N3O/c1-12(10)7(13)4-2-5(8)11-6(9)3-4/h2-3H,10H2,1H3 |
| InChIKey | LBIXEEKFDDQZKB-UHFFFAOYSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.435°C at 760 mmHg (Cal.) |
| Flash point | 187.51°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-2,6-Dichloroisonicotinic Hydrazide |