Online Database of Chemicals from Around the World
|
CAS#: 57816-08-7 Product: 7,14-Dihydrodibenz[a,h]Anthracene No suppilers available for the product. |
| Name | 7,14-Dihydrodibenz[a,h]Anthracene |
|---|---|
| Synonyms | 4-05-00-02701 (Beilstein Handbook Reference); 7,14-Dihydrodibenz(A,H)Anthracene; 9,10-Dihydro-1,2,5,6-Dibenzanthracene |
| Molecular Structure | ![CAS#: 57816-08-7, 7,14-Dihydrodibenz[a,h]Anthracene](/moreStructures/57816-08-7.gif) |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 57816-08-7 |
| SMILES | C2=CC1=CC=CC=C1C3=C2CC4=C(C3)C=CC5=CC=CC=C45 |
| InChI | 1S/C22H16/c1-3-7-19-15(5-1)9-11-17-14-22-18(13-21(17)19)12-10-16-6-2-4-8-20(16)22/h1-12H,13-14H2 |
| InChIKey | BPGFDWNRXZOHBO-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.35°C at 760 mmHg (Cal.) |
| Flash point | 239.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,14-Dihydrodibenz[a,h]Anthracene |