|
CAS#: 5787-50-8 Product: Sodium 4-Tert-Butylphenolate No suppilers available for the product. |
| Name | Sodium 4-Tert-Butylphenolate |
|---|---|
| Synonyms | 4-(1,1-Dimethylethyl)Phenol Sodium Salt; Caswell No. 130G |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NaO |
| Molecular Weight | 172.20 |
| CAS Registry Number | 5787-50-8 |
| EINECS | 227-318-4 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1)[O-].[Na+] |
| InChI | 1S/C10H14O.Na/c1-10(2,3)8-4-6-9(11)7-5-8;/h4-7,11H,1-3H3;/q;+1/p-1 |
| InChIKey | QDJPHAPWEUQBKS-UHFFFAOYSA-M |
| Boiling point | 233.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-Tert-Butylphenolate |