|
CAS#: 578740-78-0 Product: Methyl 1-Carbamoyl-L-Prolinate No suppilers available for the product. |
| Name | Methyl 1-Carbamoyl-L-Prolinate |
|---|---|
| Synonyms | (S)-methyl 1-carbamoylpyrrolidine-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 578740-78-0 |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)N |
| InChI | 1S/C7H12N2O3/c1-12-6(10)5-3-2-4-9(5)7(8)11/h5H,2-4H2,1H3,(H2,8,11)/t5-/m0/s1 |
| InChIKey | DEFXOIOJWFBIDH-YFKPBYRVSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.208°C at 760 mmHg (Cal.) |
| Flash point | 121.452°C (Cal.) |
| Refractive index | 1.517 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1-Carbamoyl-L-Prolinate |