|
CAS#: 57967-72-3 Product: [2alpha,5alpha(R*)]-2,6,10,10-Tetramethyl1-Oxaspiro[4.5]Decan-6-Yl Acetate No suppilers available for the product. |
| Name | [2alpha,5alpha(R*)]-2,6,10,10-Tetramethyl1-Oxaspiro[4.5]Decan-6-Yl Acetate |
|---|---|
| Synonyms | Acetic Acid [(2R,5S,10R)-2,6,6,10-Tetramethyl-1-Oxaspiro[4.5]Decan-10-Yl] Ester; [(2R,5S,10R)-2,6,6,10-Tetramethyl-1-Oxaspiro[4.5]Decan-10-Yl] Ethanoate; (2Alpha,5Alpha(R*))-2,6,10,10-Tetramethyl1-Oxaspiro(4.5)Decan-6-Ylacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 |
| CAS Registry Number | 57967-72-3 |
| EINECS | 261-048-8 |
| SMILES | [C@@]2(OC(=O)C)([C@@]1(O[C@@H](CC1)C)C(CCC2)(C)C)C |
| InChI | 1S/C15H26O3/c1-11-7-10-15(17-11)13(3,4)8-6-9-14(15,5)18-12(2)16/h11H,6-10H2,1-5H3/t11-,14-,15+/m1/s1 |
| InChIKey | LTAWGWRPOGXHBD-DFBGVHRSSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.616°C at 760 mmHg (Cal.) |
| Flash point | 126.906°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2alpha,5alpha(R*)]-2,6,10,10-Tetramethyl1-Oxaspiro[4.5]Decan-6-Yl Acetate |