Online Database of Chemicals from Around the World
|
CAS#: 57981-99-4 Product: 2-Chloro-1,4-Phenylene Diacetate No suppilers available for the product. |
| Name | 2-Chloro-1,4-Phenylene Diacetate |
|---|---|
| Synonyms | (4-Acetoxy-2-Chloro-Phenyl) Acetate; Acetic Acid (4-Acetoxy-2-Chlorophenyl) Ester; Acetic Acid (4-Acetoxy-2-Chloro-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.63 |
| CAS Registry Number | 57981-99-4 |
| EINECS | 261-060-3 |
| SMILES | C1=C(C(=CC=C1OC(=O)C)OC(=O)C)Cl |
| InChI | 1S/C10H9ClO4/c1-6(12)14-8-3-4-10(9(11)5-8)15-7(2)13/h3-5H,1-2H3 |
| InChIKey | BJNWFLGHFAIHAX-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.907°C at 760 mmHg (Cal.) |
| Flash point | 135.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-1,4-Phenylene Diacetate |