| Name | 1-Hydroxyquinoline-2(1H)-One |
|---|---|
| Synonyms | 1-Hydroxy-2-Quinolinone; 1-Hydroxycarbostyril; Oprea1_171952 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 58-57-1 |
| SMILES | C1=CC2=C(C=C1)C=CC(N2O)=O |
| InChI | 1S/C9H7NO2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,12H |
| InChIKey | NFNIRGPPIRJASP-UHFFFAOYSA-N |
| Density | 1.412g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.586°C at 760 mmHg (Cal.) |
| Flash point | 146.476°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Fabien Gutierrez, Christine Tedeschi, Laurent Maron, Jean-Pierre Daudey, Romuald Poteau, Joëlle Azema, Pierre Tisnès and Claude Picard. Quantum chemistry-based interpretations on the lowest triplet state of luminescent lanthanides complexes. Part 1. Relation between the triplet state energy of hydroxamate complexes and their luminesce nce properties, Dalton Trans., 2004, 0, 1334. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Hydroxyquinoline-2(1H)-One |