Online Database of Chemicals from Around the World
|
CAS#: 580-47-2 Product: (5Z,10Z,14Z,19Z)-2,7,13,18-Tetraethyl-3,8,12,17-Tetramethyl-21,23-Dihydroporphyrin No suppilers available for the product. |
| Name | (5Z,10Z,14Z,19Z)-2,7,13,18-Tetraethyl-3,8,12,17-Tetramethyl-21,23-Dihydroporphyrin |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C32H38N4 |
| Molecular Weight | 478.67 |
| CAS Registry Number | 580-47-2 |
| SMILES | CC\C2=C(/C)c1cc5nc(cc4nc(cc3nc(cc2n1)c(C)c3CC)C(\CC)=C4\C)c(CC)c5C |
| InChI | 1S/C32H38N4/c1-9-21-17(5)25-13-26-18(6)22(10-2)30(34-26)15-28-20(8)24(12-4)32(36-28)16-31-23(11-3)19(7)27(35-31)14-29(21)33-25/h13-16,33,36H,9-12H2,1-8H3/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16- |
| InChIKey | ILDKPZQVQBGQPE-UJJXFSCMSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 792.693°C at 760 mmHg (Cal.) |
| Flash point | 338.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z,10Z,14Z,19Z)-2,7,13,18-Tetraethyl-3,8,12,17-Tetramethyl-21,23-Dihydroporphyrin |