Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2,4-Di-(N,N'-Diethylamino)-6-Chlorotriazine |
|---|---|
| Synonyms | (4-Chloro-6-Diethylamino-S-Triazin-2-Yl)-Diethyl-Amine; 1,3,5-Triazine-2,4-Diamine, 6-Chloro-N,N,N',N'-Tetraethyl-; 2-Chloro-4,6-Bis(Diethylamino)-S-Triazine |
| Molecular Structure |  |
| Molecular Formula | C11H20ClN5 |
| Molecular Weight | 257.77 |
| CAS Registry Number | 580-48-3 |
| EINECS | 209-459-3 |
| SMILES | C(N(C1=NC(=NC(=N1)N(CC)CC)Cl)CC)C |
| InChI | 1S/C11H20ClN5/c1-5-16(6-2)10-13-9(12)14-11(15-10)17(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | QHXDTLYEHWXDSO-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.715°C at 760 mmHg (Cal.) |
| Flash point | 188.284°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4-Di-(N,N'-Diethylamino)-6-Chlorotriazine |