|
CAS#: 5806-89-3 Product: [4-[(4,6-Diamino-1,3,5-Triazin-2-Yl)Amino]Phenyl]Arsonic Acid No suppilers available for the product. |
| Name | [4-[(4,6-Diamino-1,3,5-Triazin-2-Yl)Amino]Phenyl]Arsonic Acid |
|---|---|
| Synonyms | [4-[(4,6-Diamino-S-Triazin-2-Yl)Amino]Phenyl]Arsonic Acid; Antineoplastic-10894; Nsc10894 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11AsN6O3 |
| Molecular Weight | 326.15 |
| CAS Registry Number | 5806-89-3 |
| EINECS | 227-365-0 |
| SMILES | C1=C([As](=O)(O)O)C=CC(=C1)NC2=NC(=NC(=N2)N)N |
| InChI | 1S/C9H11AsN6O3/c11-7-14-8(12)16-9(15-7)13-6-3-1-5(2-4-6)10(17,18)19/h1-4H,(H2,17,18,19)(H5,11,12,13,14,15,16) |
| InChIKey | VURSAWSSSICZRY-UHFFFAOYSA-N |
| Boiling point | 781.678°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 426.544°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-[(4,6-Diamino-1,3,5-Triazin-2-Yl)Amino]Phenyl]Arsonic Acid |