|
CAS#: 58109-87-8 Product: Paracetamol Cysteine No suppilers available for the product. |
| Name | Paracetamol Cysteine |
|---|---|
| Synonyms | (4-Acetamidophenyl) (2R)-2-Amino-3-Sulfanyl-Propanoate; (2R)-2-Amino-3-Mercaptopropanoic Acid (4-Acetamidophenyl) Ester; (2R)-2-Amino-3-Mercapto-Propionic Acid (4-Acetamidophenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.30 |
| CAS Registry Number | 58109-87-8 |
| SMILES | [C@H](C(OC1=CC=C(NC(=O)C)C=C1)=O)(N)CS |
| InChI | 1S/C11H14N2O3S/c1-7(14)13-8-2-4-9(5-3-8)16-11(15)10(12)6-17/h2-5,10,17H,6,12H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | VKVHWTMZJQWYBR-JTQLQIEISA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.49°C at 760 mmHg (Cal.) |
| Flash point | 247.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Paracetamol Cysteine |