Online Database of Chemicals from Around the World
|
CAS#: 58139-54-1 Product: 4-(5-Nitro-1H-Pyrrol-2-Yl)-2-Thiazolamine No suppilers available for the product. |
| Name | 4-(5-Nitro-1H-Pyrrol-2-Yl)-2-Thiazolamine |
|---|---|
| Synonyms | 4-(5-Nitro-1H-Pyrrol-2-Yl)Thiazol-2-Amine; 4-(5-Nitro-1H-Pyrrol-2-Yl)-2-Thiazolamine; [4-(5-Nitro-1H-Pyrrol-2-Yl)Thiazol-2-Yl]Amine |
| Molecular Structure |  |
| Molecular Formula | C7H6N4O2S |
| Molecular Weight | 210.21 |
| CAS Registry Number | 58139-54-1 |
| SMILES | C1=C([NH]C(=C1)C2=CSC(=N2)N)[N+]([O-])=O |
| InChI | 1S/C7H6N4O2S/c8-7-10-5(3-14-7)4-1-2-6(9-4)11(12)13/h1-3,9H,(H2,8,10) |
| InChIKey | GMMLYJLONARTJT-UHFFFAOYSA-N |
| Density | 1.619g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.589°C at 760 mmHg (Cal.) |
| Flash point | 272.271°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(5-Nitro-1H-Pyrrol-2-Yl)-2-Thiazolamine |