|
CAS#: 58168-11-9 Product: 3-Chloropropyl 4-Nitrobenzoate No suppilers available for the product. |
| Name | 3-Chloropropyl 4-Nitrobenzoate |
|---|---|
| Synonyms | 4-Nitrobenzoic Acid 3-Chloropropyl Ester; Nsc74790 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 |
| CAS Registry Number | 58168-11-9 |
| SMILES | C1=CC(=CC=C1C(=O)OCCCCl)[N+]([O-])=O |
| InChI | 1S/C10H10ClNO4/c11-6-1-7-16-10(13)8-2-4-9(5-3-8)12(14)15/h2-5H,1,6-7H2 |
| InChIKey | AODHIKQFOZZUBA-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.904°C at 760 mmHg (Cal.) |
| Flash point | 189.003°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloropropyl 4-Nitrobenzoate |