Online Database of Chemicals from Around the World
|
CAS#: 58212-86-5 Product: Estra-1,3,5(10),7-Tetraene-3,17alpha-Diol 17-Acetate No suppilers available for the product. |
| Name | Estra-1,3,5(10),7-Tetraene-3,17alpha-Diol 17-Acetate |
|---|---|
| Synonyms | Acetic Acid (3-Hydroxy-13-Methyl-8,9,11,12,14,15,16,17-Octahydrocyclopenta[A]Phenanthren-17-Yl) Ester; (3-Hydroxy-13-Methyl-8,9,11,12,14,15,16,17-Octahydrocyclopenta[A]Phenanthren-17-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 |
| CAS Registry Number | 58212-86-5 |
| EINECS | 261-168-0 |
| SMILES | C1=CC(=CC4=C1C3C(C2C(C(OC(=O)C)CC2)(CC3)C)C=C4)O |
| InChI | 1S/C20H24O3/c1-12(21)23-19-8-7-18-17-5-3-13-11-14(22)4-6-15(13)16(17)9-10-20(18,19)2/h3-6,11,16-19,22H,7-10H2,1-2H3 |
| InChIKey | QJTKPDAQOKYHLW-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.695°C at 760 mmHg (Cal.) |
| Flash point | 186.394°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Estra-1,3,5(10),7-Tetraene-3,17alpha-Diol 17-Acetate |