|
CAS#: 582293-43-4 Product: 3-(Trifluoromethyl)-4-Biphenylcarbonitrile No suppilers available for the product. |
| Name | 3-(Trifluoromethyl)-4-Biphenylcarbonitrile |
|---|---|
| Synonyms | 4-Cyano-3-(trifluoromethyl)biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8F3N |
| Molecular Weight | 247.22 |
| CAS Registry Number | 582293-43-4 |
| SMILES | c1ccc(cc1)c2ccc(c(c2)C(F)(F)F)C#N |
| InChI | 1S/C14H8F3N/c15-14(16,17)13-8-11(6-7-12(13)9-18)10-4-2-1-3-5-10/h1-8H |
| InChIKey | VXQOTSMKPZJMGC-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.953°C at 760 mmHg (Cal.) |
| Flash point | 164.236°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Trifluoromethyl)-4-Biphenylcarbonitrile |