|
CAS#: 58288-41-8 Product: Potassium 4-Octylphenolate No suppilers available for the product. |
| Name | Potassium 4-Octylphenolate |
|---|---|
| Synonyms | Phenol, 4-Octyl-, Potassium Salt; Potassium P-Octylphenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21KO |
| Molecular Weight | 244.42 |
| CAS Registry Number | 58288-41-8 |
| EINECS | 261-198-4 |
| SMILES | C1=C(C=CC(=C1)[O-])CCCCCCCC.[K+] |
| InChI | 1S/C14H22O.K/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;/h9-12,15H,2-8H2,1H3;/q;+1/p-1 |
| InChIKey | KXPNDAJGKXDUDY-UHFFFAOYSA-M |
| Boiling point | 314.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 172.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 4-Octylphenolate |