|
CAS#: 58330-14-6 Product: 1-(4-Chlorophenyl)-6-(4-Methylphenyl)-1,3,4,6-Hexanetetrone No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)-6-(4-Methylphenyl)-1,3,4,6-Hexanetetrone |
|---|---|
| Synonyms | 1-(4-Chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15ClO4 |
| Molecular Weight | 342.77 |
| CAS Registry Number | 58330-14-6 |
| SMILES | O=C(c1ccc(Cl)cc1)CC(=O)C(=O)CC(=O)c2ccc(cc2)C |
| InChI | 1S/C19H15ClO4/c1-12-2-4-13(5-3-12)16(21)10-18(23)19(24)11-17(22)14-6-8-15(20)9-7-14/h2-9H,10-11H2,1H3 |
| InChIKey | AGWWIHGBSYUTPT-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.23°C at 760 mmHg (Cal.) |
| Flash point | 215.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-6-(4-Methylphenyl)-1,3,4,6-Hexanetetrone |