|
CAS#: 58344-54-0 Product: 5,5-Dimethyl-1-(1,3-Benzodioxol-5-Yl)-1-Hexen-3-One No suppilers available for the product. |
| Name | 5,5-Dimethyl-1-(1,3-Benzodioxol-5-Yl)-1-Hexen-3-One |
|---|---|
| Synonyms | (E)-1-(1,3-Benzodioxol-5-Yl)-5,5-Dimethyl-Hex-1-En-3-One; 1-Hexen-3-One, 5,5-Dimethyl-1-(3,4-Methylenedioxyphenyl)-; 5,5-Dimethyl-1-(3,4-Methylenedioxyphenyl)-1-Hexen-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 |
| CAS Registry Number | 58344-54-0 |
| SMILES | C1=C2C(=CC=C1\C=C\C(CC(C)(C)C)=O)OCO2 |
| InChI | 1S/C15H18O3/c1-15(2,3)9-12(16)6-4-11-5-7-13-14(8-11)18-10-17-13/h4-8H,9-10H2,1-3H3/b6-4+ |
| InChIKey | LNGZEQJRNZOUHD-GQCTYLIASA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.32°C at 760 mmHg (Cal.) |
| Flash point | 170.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-1-(1,3-Benzodioxol-5-Yl)-1-Hexen-3-One |