|
CAS#: 58377-72-3 Product: Chloridophosphoric Acid Bis(2,5-Dimethylphenyl) Ester No suppilers available for the product. |
| Name | Chloridophosphoric Acid Bis(2,5-Dimethylphenyl) Ester |
|---|---|
| Synonyms | 2-[Chloro-(2,5-Dimethylphenoxy)Phosphoryl]Oxy-1,4-Dimethyl-Benzene; Phosphorochloridic Acid, Bis(2,5-Dimethylphenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18ClO3P |
| Molecular Weight | 324.74 |
| CAS Registry Number | 58377-72-3 |
| SMILES | C2=C(O[P](OC1=CC(=CC=C1C)C)(=O)Cl)C(=CC=C2C)C |
| InChI | 1S/C16H18ClO3P/c1-11-5-7-13(3)15(9-11)19-21(17,18)20-16-10-12(2)6-8-14(16)4/h5-10H,1-4H3 |
| InChIKey | RGARJWLLEMKZPT-UHFFFAOYSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.767°C at 760 mmHg (Cal.) |
| Flash point | 341.937°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloridophosphoric Acid Bis(2,5-Dimethylphenyl) Ester |