|
CAS#: 58430-00-5 Product: 8,9-Dimethylbenz[a]Anthracene No suppilers available for the product. |
| Name | 8,9-Dimethylbenz[a]Anthracene |
|---|---|
| Synonyms | Brn 3261103; 3-05-00-02414 (Beilstein Handbook Reference); 5,6-Dimethyl-1,2-Benzanthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 58430-00-5 |
| SMILES | C4=CC3=CC1=C(C=CC2=CC=CC=C12)C=C3C(=C4C)C |
| InChI | 1S/C20H16/c1-13-7-8-16-12-20-17(11-19(16)14(13)2)10-9-15-5-3-4-6-18(15)20/h3-12H,1-2H3 |
| InChIKey | PYYMVIMLYZWIHJ-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.474°C at 760 mmHg (Cal.) |
| Flash point | 229.115°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,9-Dimethylbenz[a]Anthracene |