|
CAS#: 5847-74-5 Product: 3-[(E)-2-(4-Nitrophenyl)Ethenyl]Pyridine No suppilers available for the product. |
| Name | 3-[(E)-2-(4-Nitrophenyl)Ethenyl]Pyridine |
|---|---|
| Synonyms | 3-[(E)-2-(4-Nitrophenyl)Vinyl]Pyridine; Pyridine, Trans-3-(2-(4-Nitrophenyl)Ethenyl)-; Pyridine,Trans-3-[2-(4-Nitrophenyl)Ethenyl]- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 5847-74-5 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)\C=C\C2=CC=CN=C2 |
| InChI | 1S/C13H10N2O2/c16-15(17)13-7-5-11(6-8-13)3-4-12-2-1-9-14-10-12/h1-10H/b4-3+ |
| InChIKey | YPRDMJYMSUFTLX-ONEGZZNKSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 358°C at 760 mmHg (Cal.) |
| Flash point | 170.312°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(E)-2-(4-Nitrophenyl)Ethenyl]Pyridine |