|
CAS#: 585-18-2 Product: (2,3-Dihydroxy-4-Oxo-Butoxy)Phosphonic Acid No suppilers available for the product. |
| Name | (2,3-Dihydroxy-4-Oxo-Butoxy)Phosphonic Acid |
|---|---|
| Synonyms | (2,3-Dihydroxy-4-Oxo-Butyl) Dihydrogen Phosphate; (2,3-Dihydroxy-4-Keto-Butyl) Dihydrogen Phosphate; D-Erythrose 4-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9O7P |
| Molecular Weight | 200.08 |
| CAS Registry Number | 585-18-2 |
| SMILES | C(C(C(C=O)O)O)O[P](=O)(O)O |
| InChI | 1S/C4H9O7P/c5-1-3(6)4(7)2-11-12(8,9)10/h1,3-4,6-7H,2H2,(H2,8,9,10) |
| InChIKey | NGHMDNPXVRFFGS-UHFFFAOYSA-N |
| Density | 1.768g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.469°C at 760 mmHg (Cal.) |
| Flash point | 245.589°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2,3-Dihydroxy-4-Oxo-Butoxy)Phosphonic Acid |