|
CAS#: 58502-84-4 Product: 3,6-Diisopropylbenzyl chloride No suppilers available for the product. |
| Name | 3,6-Diisopropylbenzyl chloride |
|---|---|
| Synonyms | 2-(Chloromethyl)-1,4-Diisopropyl-Benzene; 2-(Chloromethyl)-1,4-Diisopropylbenzene; 3,6-Diisopropylbenzyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 |
| CAS Registry Number | 58502-84-4 |
| SMILES | C1=C(C=CC(=C1CCl)C(C)C)C(C)C |
| InChI | 1S/C13H19Cl/c1-9(2)11-5-6-13(10(3)4)12(7-11)8-14/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | QWGSROBWVPQERA-UHFFFAOYSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.652°C at 760 mmHg (Cal.) |
| Flash point | 111.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Diisopropylbenzyl chloride |