Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,2'-Dinitrobenzidine |
|---|---|
| Synonyms | 4-(4-Amino-2-Nitro-Phenyl)-3-Nitro-Aniline; [4-(4-Amino-2-Nitro-Phenyl)-3-Nitro-Phenyl]Amine; 2,2'-Dinitrobenzidine |
| Molecular Structure |  |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 |
| CAS Registry Number | 5855-71-0 |
| SMILES | C1=CC(=CC(=C1C2=C([N+]([O-])=O)C=C(N)C=C2)[N+]([O-])=O)N |
| InChI | 1S/C12H10N4O4/c13-7-1-3-9(11(5-7)15(17)18)10-4-2-8(14)6-12(10)16(19)20/h1-6H,13-14H2 |
| InChIKey | FEJXQZAKAOGYBC-UHFFFAOYSA-N |
| Density | 1.499g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.438°C at 760 mmHg (Cal.) |
| Flash point | 255.851°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Dinitrobenzidine |