|
CAS#: 58654-36-7 Product: 5-Methylhexan-2-One Tert-Butylhydrazone No suppilers available for the product. |
| Name | 5-Methylhexan-2-One Tert-Butylhydrazone |
|---|---|
| Synonyms | N-(1,4-Dimethylpentylideneamino)-2-Methyl-Propan-2-Amine; N-(1,4-Dimethylpentylideneamino)-2-Methylpropan-2-Amine; Tert-Butyl-(1,4-Dimethylpentylideneamino)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.32 |
| CAS Registry Number | 58654-36-7 |
| EINECS | 261-380-3 |
| SMILES | C(/C(=N/NC(C)(C)C)C)CC(C)C |
| InChI | 1S/C11H24N2/c1-9(2)7-8-10(3)12-13-11(4,5)6/h9,13H,7-8H2,1-6H3/b12-10+ |
| InChIKey | CBLLQLCAUGKBOU-ZRDIBKRKSA-N |
| Density | 0.841g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.709°C at 760 mmHg (Cal.) |
| Flash point | 98.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methylhexan-2-One Tert-Butylhydrazone |