|
CAS#: 58673-43-1 Product: 1,4-Dihydro-5-Nitro-1,4-Methanonaphthalene No suppilers available for the product. |
| Name | 1,4-Dihydro-5-Nitro-1,4-Methanonaphthalene |
|---|---|
| Synonyms | 1,4-Methanonaphthalene,1,4-Dihydro-5-Nitro-; 1,4-Methanonaphthalene, 1,4-Dihydro-5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 |
| CAS Registry Number | 58673-43-1 |
| SMILES | C1=C2C(=C([N+]([O-])=O)C=C1)C3CC2C=C3 |
| InChI | 1S/C11H9NO2/c13-12(14)10-3-1-2-9-7-4-5-8(6-7)11(9)10/h1-5,7-8H,6H2 |
| InChIKey | WDACAIAYIWOBAP-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.975°C at 760 mmHg (Cal.) |
| Flash point | 120.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dihydro-5-Nitro-1,4-Methanonaphthalene |