|
CAS#: 587-20-2 Product: alpha-Methylhistidine No suppilers available for the product. |
| Name | alpha-Methylhistidine |
|---|---|
| Synonyms | (2S)-2-Amino-3-(3H-Imidazol-4-Yl)-2-Methyl-Propanoic Acid; (2S)-2-Amino-3-(3H-Imidazol-4-Yl)-2-Methyl-Propionic Acid; Histidine, Alpha-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 |
| CAS Registry Number | 587-20-2 |
| SMILES | [C@@](C(=O)O)(N)(CC1=CN=C[NH]1)C |
| InChI | 1S/C7H11N3O2/c1-7(8,6(11)12)2-5-3-9-4-10-5/h3-4H,2,8H2,1H3,(H,9,10)(H,11,12)/t7-/m0/s1 |
| InChIKey | HRRYYCWYCMJNGA-ZETCQYMHSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.417°C at 760 mmHg (Cal.) |
| Flash point | 219.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methylhistidine |