Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Propyl 3,5-diiodo-4-pyridone-N-acetate |
|---|---|
| Synonyms | Propyl 2-(3,5-Diiodo-4-Oxo-1-Pyridyl)Acetate; 2-(3,5-Diiodo-4-Oxo-1-Pyridyl)Acetic Acid Propyl Ester; 2-(3,5-Diiodo-4-Keto-1-Pyridyl)Acetic Acid Propyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H11I2NO3 |
| Molecular Weight | 447.01 |
| CAS Registry Number | 587-61-1 |
| EINECS | 209-603-5 |
| SMILES | C(N1C=C(C(=O)C(=C1)I)I)C(OCCC)=O |
| InChI | 1S/C10H11I2NO3/c1-2-3-16-9(14)6-13-4-7(11)10(15)8(12)5-13/h4-5H,2-3,6H2,1H3 |
| InChIKey | ROSXARVHJNYYDO-UHFFFAOYSA-N |
| Density | 2.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.582°C at 760 mmHg (Cal.) |
| Flash point | 191.227°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propyl 3,5-diiodo-4-pyridone-N-acetate |