Online Database of Chemicals from Around the World
| Name | 4-Methyl-12-(1-Methylvinyl)-8-Oxo-3,7,17-Trioxatetracyclo[12.2.1.16,9.02,4]Octadeca-9(18),14,16(1)-Triene-15-Carboxylic Acid Methyl Ester |
|---|---|
| Synonyms | Pukalide; Nsc217990; Sc-1 |
| Molecular Structure | ![CAS#: 58772-81-9, 4-Methyl-12-(1-Methylvinyl)-8-Oxo-3,7,17-Trioxatetracyclo[12.2.1.16,9.02,4]Octadeca-9(18),14,16(1)-Triene-15-Carboxylic Acid Methyl Ester](/moreStructures/58772-81-9.gif) |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 |
| CAS Registry Number | 58772-81-9 |
| SMILES | O1C4=C(C=C1C2C(O2)(CC3OC(=O)C(=C3)CCC(C4)C(=C)C)C)C(=O)OC |
| InChI | 1S/C21H24O6/c1-11(2)12-5-6-13-7-14(25-19(13)22)10-21(3)18(27-21)17-9-15(20(23)24-4)16(8-12)26-17/h7,9,12,14,18H,1,5-6,8,10H2,2-4H3 |
| InChIKey | PPHCYWKQJLNLQQ-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.45°C at 760 mmHg (Cal.) |
| Flash point | 296.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-12-(1-Methylvinyl)-8-Oxo-3,7,17-Trioxatetracyclo[12.2.1.16,9.02,4]Octadeca-9(18),14,16(1)-Triene-15-Carboxylic Acid Methyl Ester |
