|
CAS#: 58791-45-0 Product: 1,4-Anthracenedicarboxylic Acid No suppilers available for the product. |
| Name | 1,4-Anthracenedicarboxylic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 58791-45-0 |
| SMILES | OC(=O)c1ccc(C(O)=O)c2cc3ccccc3cc12 |
| InChI | 1S/C16H10O4/c17-15(18)11-5-6-12(16(19)20)14-8-10-4-2-1-3-9(10)7-13(11)14/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | HJGMZNDYNFRASP-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 575.973°C at 760 mmHg (Cal.) |
| Flash point | 316.182°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Anthracenedicarboxylic Acid |