Online Database of Chemicals from Around the World
|
CAS#: 58800-19-4 Product: Isofumigaclavine A No suppilers available for the product. |
| Name | Isofumigaclavine A |
|---|---|
| Synonyms | Ergolin-9-Ol, 6,8-Dimethyl-, Acetate (Ester), (8Beta,9Alpha)-; Isofumigaclavine A |
| Molecular Structure |  |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.38 |
| CAS Registry Number | 58800-19-4 |
| SMILES | [C@@H]14C([C@@H]([C@H](CN1C)C)OC(=O)C)C2=C3C(=CC=C2)[NH]C=C3C4 |
| InChI | 1S/C18H22N2O2/c1-10-9-20(3)15-7-12-8-19-14-6-4-5-13(16(12)14)17(15)18(10)22-11(2)21/h4-6,8,10,15,17-19H,7,9H2,1-3H3/t10-,15+,17?,18+/m0/s1 |
| InChIKey | GJSSYQDXZLZOLR-HQNFJNNYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.943°C at 760 mmHg (Cal.) |
| Flash point | 230.151°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isofumigaclavine A |