|
CAS#: 58848-15-0 Product: 1,1,4,4,6,7-Hexamethyltetralin No suppilers available for the product. |
| Name | 1,1,4,4,6,7-Hexamethyltetralin |
|---|---|
| Synonyms | 1,1,4,4,6,7-Hexamethyltetralin; Nsc19540 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 |
| CAS Registry Number | 58848-15-0 |
| SMILES | C1=C(C)C(=CC2=C1C(C)(CCC2(C)C)C)C |
| InChI | 1S/C16H24/c1-11-9-13-14(10-12(11)2)16(5,6)8-7-15(13,3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | OBUKANCGVSOHAC-UHFFFAOYSA-N |
| Density | 0.881g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.82°C at 760 mmHg (Cal.) |
| Flash point | 124.099°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,4,4,6,7-Hexamethyltetralin |