|
CAS#: 58888-75-8 Product: Trichloropropyl phosphate No suppilers available for the product. |
| Name | Trichloropropyl phosphate |
|---|---|
| Synonyms | 1-Propanol, Trichloro-, Dihydrogen Phosphate; Trichloropropylphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C3H6Cl3O4P |
| Molecular Weight | 243.41 |
| CAS Registry Number | 58888-75-8 |
| SMILES | CC(C(O[P](O)(=O)O)(Cl)Cl)Cl |
| InChI | 1S/C3H6Cl3O4P/c1-2(4)3(5,6)10-11(7,8)9/h2H,1H3,(H2,7,8,9) |
| InChIKey | LOOCNDFTHKSTFY-UHFFFAOYSA-N |
| Density | 1.762g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.296°C at 760 mmHg (Cal.) |
| Flash point | 148.115°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloropropyl phosphate |