|
CAS#: 5890-93-7 Product: 4,4'-[1H-Indole-2,3-Diyl]Bis(Phenol) No suppilers available for the product. |
| Name | 4,4'-[1H-Indole-2,3-Diyl]Bis(Phenol) |
|---|---|
| Synonyms | 4,4'-Indole-2,3-Diyldiphenol; Brn 1541731; Phenol, 4,4'-Indole-2,3-Diyldi- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.34 |
| CAS Registry Number | 5890-93-7 |
| SMILES | C1=CC=CC2=C1C(=C([NH]2)C3=CC=C(O)C=C3)C4=CC=C(O)C=C4 |
| InChI | 1S/C20H15NO2/c22-15-9-5-13(6-10-15)19-17-3-1-2-4-18(17)21-20(19)14-7-11-16(23)12-8-14/h1-12,21-23H |
| InChIKey | MGOARPQWMKCCSF-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.07°C at 760 mmHg (Cal.) |
| Flash point | 273.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-[1H-Indole-2,3-Diyl]Bis(Phenol) |