|
CAS#: 58962-45-1 Product: Potassium 4-Chloro-3,5-Xylenolate No suppilers available for the product. |
| Name | Potassium 4-Chloro-3,5-Xylenolate |
|---|---|
| Synonyms | Potassium 4-Chloro-3,5-Dimethyl-Phenolate; Potassium 4-Chloro-3,5-Xylenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClKO |
| Molecular Weight | 194.70 |
| CAS Registry Number | 58962-45-1 |
| EINECS | 261-522-4 |
| SMILES | C1=C([O-])C=C(C(=C1C)Cl)C.[K+] |
| InChI | 1S/C8H9ClO.K/c1-5-3-7(10)4-6(2)8(5)9;/h3-4,10H,1-2H3;/q;+1/p-1 |
| InChIKey | WOIZAYMWBHBKKX-UHFFFAOYSA-M |
| Boiling point | 246°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 105.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 4-Chloro-3,5-Xylenolate |