Online Database of Chemicals from Around the World
| Name | 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Ester; 2-Methylacrylic Acid 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Ester |
| Molecular Structure |  |
| Molecular Formula | C9H7F9O2 |
| Molecular Weight | 318.14 |
| CAS Registry Number | 59006-65-4 |
| EINECS | 261-553-3 |
| SMILES | C(OC(C(=C)C)=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
| InChI | 1S/C9H7F9O2/c1-4(2)5(19)20-3-6(10,11)7(12,13)8(14,15)9(16,17)18/h1,3H2,2H3 |
| InChIKey | XBZLJCYNLZUIGP-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 167.456°C at 760 mmHg (Cal.) |
| Flash point | 54.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,5-Nonafluoropentyl Methacrylate |
