|
CAS#: 5902-52-3 Product: Narlene No suppilers available for the product. |
| Name | Narlene |
|---|---|
| Synonyms | 1-(Amino-Methoxy-Phosphinothioyl)Oxy-4-Tert-Butyl-2-Chloro-Benzene; [(4-Tert-Butyl-2-Chloro-Phenoxy)-Methoxy-Thiophosphoryl]Amine; 4-06-00-03313 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17ClNO2PS |
| Molecular Weight | 293.75 |
| CAS Registry Number | 5902-52-3 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1Cl)O[P](=S)(N)OC |
| InChI | 1S/C11H17ClNO2PS/c1-11(2,3)8-5-6-10(9(12)7-8)15-16(13,17)14-4/h5-7H,1-4H3,(H2,13,17) |
| InChIKey | HAJQRNZSYDJREE-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.003°C at 760 mmHg (Cal.) |
| Flash point | 166.081°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Narlene |