|
CAS#: 59054-99-8 Product: (E)-2-Methyl-2-Butene-1,4-Diyl Diacetate No suppilers available for the product. |
| Name | (E)-2-Methyl-2-Butene-1,4-Diyl Diacetate |
|---|---|
| Synonyms | [(E)-4-Acetoxy-3-Methyl-But-2-Enyl] Acetate; Acetic Acid [(E)-4-Acetoxy-3-Methylbut-2-Enyl] Ester; Acetic Acid [(E)-4-Acetoxy-3-Methyl-But-2-Enyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 59054-99-8 (59055-00-4) |
| EINECS | 261-576-9 |
| SMILES | C(OC(=O)C)\C(=C\COC(=O)C)C |
| InChI | 1S/C9H14O4/c1-7(6-13-9(3)11)4-5-12-8(2)10/h4H,5-6H2,1-3H3/b7-4+ |
| InChIKey | LJPNEMAMFITRSO-QPJJXVBHSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.6°C at 760 mmHg (Cal.) |
| Flash point | 116.332°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-2-Methyl-2-Butene-1,4-Diyl Diacetate |