|
CAS#: 59118-15-9 Product: 5,7-Dihydro-5,5,7,7-Tetramethyl-3-(3-Nitrophenyl)Furo(3,4-e)-As-Triazine 4-Oxide No suppilers available for the product. |
| Name | 5,7-Dihydro-5,5,7,7-Tetramethyl-3-(3-Nitrophenyl)Furo(3,4-e)-As-Triazine 4-Oxide |
|---|---|
| Synonyms | 5,5,7,7-Tetramethyl-3-(3-Nitrophenyl)-4-Oxido-Furo[3,4-E][1,2,4]Triazin-4-Ium; 5,7-Dihydro-5,5,7,7-Tetramethyl-3-(3-Nitrophenyl)Furo(3,4-E)-As-Triazine 4-Oxide; Dhtm-Npfto |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 |
| CAS Registry Number | 59118-15-9 |
| SMILES | C3=C(C2=[N+](C1=C(C(C)(C)OC1(C)C)N=N2)[O-])C=CC=C3[N+](=O)[O-] |
| InChI | 1S/C15H16N4O4/c1-14(2)11-12(15(3,4)23-14)18(20)13(17-16-11)9-6-5-7-10(8-9)19(21)22/h5-8H,1-4H3 |
| InChIKey | RXJWBJGNIOZICN-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.651°C at 760 mmHg (Cal.) |
| Flash point | 267.471°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,7-Dihydro-5,5,7,7-Tetramethyl-3-(3-Nitrophenyl)Furo(3,4-e)-As-Triazine 4-Oxide |