|
CAS#: 59130-21-1 Product: 1,1-Dichloro-2,3-diphenylcyclopropane No suppilers available for the product. |
| Name | 1,1-Dichloro-2,3-diphenylcyclopropane |
|---|---|
| Synonyms | (2,2-Dichloro-3-Phenyl-Cyclopropyl)Benzene; Tamoxifen Analog Ii; Nci60_035656 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl2 |
| Molecular Weight | 263.17 |
| CAS Registry Number | 59130-21-1 |
| SMILES | C3=C(C1C(Cl)(Cl)C1C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C15H12Cl2/c16-15(17)13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | DJDNTZDWSNETAS-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.444°C at 760 mmHg (Cal.) |
| Flash point | 165.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dichloro-2,3-diphenylcyclopropane |