Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,6-Dihydroimidazo[4,5-e]Indole |
|---|---|
| Molecular Structure | ![CAS#: 59156-95-5, 1,6-Dihydroimidazo[4,5-e]Indole](/moreStructures/59156-95-5.gif) |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.17 |
| CAS Registry Number | 59156-95-5 |
| SMILES | C1=CC2=C(C3=C1NC=C3)NC=N2 |
| InChI | 1S/C9H7N3/c1-2-8-9(12-5-11-8)6-3-4-10-7(1)6/h1-5,10H,(H,11,12) |
| InChIKey | CPKVLXBRTAAKLL-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.4±23.0°C at 760 mmHg (Cal.) |
| Flash point | 280.1±15.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dihydroimidazo[4,5-e]Indole |