Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Bis-(2,2-dinitropropyl) acetal formaldehyde |
|---|---|
| Synonyms | 1-(2,2-Dinitropropoxymethoxy)-2,2-Dinitro-Propane; Bis(2,2-Dinitropropoxy)Methane; Propane, 1,1'-(Methylenebis(Oxy))Bis(2-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C7H12N4O10 |
| Molecular Weight | 312.19 |
| CAS Registry Number | 5917-61-3 |
| SMILES | C(C([N+]([O-])=O)([N+]([O-])=O)C)OCOCC([N+]([O-])=O)([N+]([O-])=O)C |
| InChI | 1S/C7H12N4O10/c1-6(8(12)13,9(14)15)3-20-5-21-4-7(2,10(16)17)11(18)19/h3-5H2,1-2H3 |
| InChIKey | ZQXWPHXDXHONFS-UHFFFAOYSA-N |
| Density | 1.501g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.338°C at 760 mmHg (Cal.) |
| Flash point | 186.104°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis-(2,2-dinitropropyl) acetal formaldehyde |